CAS 1032903-66-4

5-Methyl-2-(1-methylethoxy)-4-(1-methyl-4-piperidinyl)benzenamine

Description:

5-Methyl-2-(1-methylethoxy)-4-(1-methyl-4-piperidinyl)benzenamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with various functional groups. The presence of a methyl group and an ethoxy group contributes to its hydrophobic characteristics, while the piperidine moiety introduces basic properties due to the nitrogen atom. This compound may exhibit biological activity, potentially interacting with specific receptors or enzymes, which is common for amine-containing compounds. Its molecular structure suggests it could be lipophilic, influencing its solubility and permeability in biological systems. The CAS number 1032903-66-4 uniquely identifies this substance in chemical databases, facilitating its study and application in research and industry. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, the characteristics of this compound make it of interest in medicinal chemistry and related fields, where understanding its properties can lead to the development of new therapeutic agents.

Formula: C₁₆H₂₆N₂O

InChI: InChI=1S/C16H26N2O/c1-11(2)19-16-10-14(12(3)9-15(16)17)13-5-7-18(4)8-6-13/h9-11,13H,5-8,17H2,1-4H3

InChI key: InChIKey=IMIFVLVXAQDYQA-UHFFFAOYSA-N

SMILES: CC=1C(=CC(OC(C)C)=C(N)C1)C2CCN(C)CC2

Synonyms:

• [2-Isopropoxy-5-methyl-4-(1-methylpiperidin-4-yl)phenyl]amine
• 2-Isopropoxy-5-methyl-4-(1-methylpiperidin-4-yl)benzenamine
• 2-Isopropoxy-5-methyl-4-(1-methylpiperidin-4-yl)aniline
• Benzenamine, 5-methyl-2-(1-methylethoxy)-4-(1-methyl-4-piperidinyl)-
• 5-Methyl-2-(1-methylethoxy)-4-(1-methyl-4-piperidinyl)benzenamine