CAS 103301-72-0

guanosine 5'-diphosphoglucose sodium

Description:

Guanosine 5'-diphosphoglucose sodium, commonly referred to as GDP-glucose sodium, is a nucleotide sugar that plays a crucial role in carbohydrate metabolism. It is a derivative of guanosine triphosphate (GTP) and glucose, featuring a guanosine moiety linked to a diphosphate group and a glucose unit. This compound serves as an essential substrate in various biochemical pathways, particularly in the synthesis of glycogen and glycoproteins. GDP-glucose acts as a donor of glucose residues, facilitating the transfer of glucose to growing polysaccharide chains. The sodium salt form enhances its solubility in aqueous solutions, making it more accessible for enzymatic reactions. GDP-glucose is also involved in signaling pathways and can influence metabolic processes. Its stability and reactivity are influenced by pH and temperature, which are critical factors in laboratory and industrial applications. Overall, GDP-glucose sodium is a vital molecule in biochemistry, contributing to energy storage and cellular signaling mechanisms.

Formula: C₁₆H₂₅N₅NaO₁₆P₂

InChI: InChI=1/C16H25N5O16P2.Na/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15;/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28);

SMILES: C(C1C(C(C(C(O1)OP(=O)(O)OP(=O)(O)OCC1C(C(C(n2cnc3c2[nH]c(=N)nc3O)O1)O)O)O)O)O)O.[Na]

GDP-D-glucose sodium salt

CAS: 103301-72-0

Substrate for glucosyltransferase

Formula: C₁₆H₂₅N₅O₁₆P₂·2Na

Purity: Min. 95 Area-%

Color and Shape: White Off-White Powder

Molecular weight: 651.34 g/mol

Ref: 3D-MG31129

GDP-D-glucose Disodium Salt

Controlled Product

CAS: 103301-72-0

Formula: C₁₆H₂₃N₅O₁₆P₂Na₂

Color and Shape: Neat

Molecular weight: 649.305

Ref: TR-G209115