CAS 103302-12-1
:4-O-ú-D-Galactopyranosyl-ù-D-mannopyranose monohydrate
Description:
4-O-β-D-Galactopyranosyl-α-D-mannopyranose monohydrate is a disaccharide compound formed from the glycosidic linkage between galactose and mannose, two monosaccharides. This compound is characterized by its specific stereochemistry, which influences its solubility and reactivity. As a monohydrate, it contains one molecule of water per molecule of the disaccharide, affecting its physical properties such as melting point and stability. The presence of hydroxyl groups in its structure contributes to its hydrophilicity, making it soluble in water and potentially useful in various biochemical applications. This compound may exhibit biological activity, including prebiotic effects or interactions with specific receptors, which can be of interest in pharmaceutical and nutritional research. Its CAS number, 103302-12-1, allows for precise identification in chemical databases, facilitating further study and application in fields such as glycoscience and carbohydrate chemistry. Overall, the unique structural features of this compound make it a subject of interest for researchers exploring carbohydrate interactions and functionalities.
Formula:C12H24O12
InChI:InChI=1/C12H22O11.H2O/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17;/h3-20H,1-2H2;1H2/t3-,4-,5+,6+,7-,8+,9-,10-,11+,12+;/m1./s1
Synonyms:- (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)tetrahydropyran-3-yl]oxy-tetrahydropyran-3,4,5-triol hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
