CAS 103305-01-7
:Pentafluoroethylphosphonic acid
Description:
Pentafluoroethylphosphonic acid is a chemical compound characterized by its unique structure, which includes a phosphonic acid group and five fluorine atoms attached to an ethyl group. This compound is notable for its high fluorine content, which imparts significant chemical stability and hydrophobic properties. It is typically a colorless to pale yellow liquid and is soluble in polar solvents. The presence of the phosphonic acid functional group makes it a strong acid, capable of donating protons in aqueous solutions. Pentafluoroethylphosphonic acid is of interest in various fields, including materials science and organic synthesis, due to its potential applications in the development of fluorinated compounds and as a reagent in chemical reactions. Its unique properties also make it a subject of study in environmental chemistry, particularly concerning its behavior and persistence in ecosystems. Safety precautions are necessary when handling this compound, as it can be hazardous due to its corrosive nature and potential environmental impact.
Formula:C2F5O3P
InChI:InChI=1/C2H2F5O3P/c3-1(4,5)2(6,7)11(8,9)10/h(H2,8,9,10)/p-2
SMILES:C(C(F)(F)P(=O)([O-])[O-])(F)(F)F
Synonyms:- (Pentafluoroethyl)Phosphonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
