CAS 103317-31-3
:4-(2-Chloro-4-thiazolyl)pyridine
Description:
4-(2-Chloro-4-thiazolyl)pyridine is a heterocyclic compound characterized by the presence of both a pyridine and a thiazole ring in its structure. The compound features a chlorine substituent on the thiazole ring, which contributes to its chemical reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in organic solvents. This compound is of interest in medicinal chemistry due to its potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. Its unique structural features may impart specific interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of the thiazole moiety can enhance its pharmacological properties, such as antimicrobial or anti-inflammatory activities. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity. Overall, 4-(2-Chloro-4-thiazolyl)pyridine represents a valuable compound in the field of organic synthesis and medicinal chemistry.
Formula:C8H5ClN2S
InChI:InChI=1S/C8H5ClN2S/c9-8-11-7(5-12-8)6-1-3-10-4-2-6/h1-5H
InChI key:InChIKey=TWQFKBIJNBKFMW-UHFFFAOYSA-N
SMILES:ClC1=NC(=CS1)C=2C=CN=CC2
Synonyms:- 2-Chloro-4-(4-pyridyl)-1,3-thiazole
- 4-(2-Chloro-4-thiazolyl)pyridine
- Pyridine, 4-(2-chloro-4-thiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.