CAS 1033194-57-8

1,1-Dimethylethyl N-[1-[(hydroxyimino)methyl]-2-phenylethyl]carbamate

Description:

1,1-Dimethylethyl N-[1-[(hydroxyimino)methyl]-2-phenylethyl]carbamate, identified by its CAS number 1033194-57-8, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a carbamate functional group, which is known for its applications in agriculture, particularly as a pesticide or herbicide. The compound includes a dimethyl group, contributing to its steric hindrance, and a phenylethyl moiety, which may enhance its biological activity. The hydroxyimino group suggests potential reactivity and stability under certain conditions, making it of interest in synthetic chemistry. Its solubility, stability, and reactivity can vary based on environmental factors such as pH and temperature. While specific physical properties like melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high stability and may interact with biological systems, warranting further investigation for potential applications in crop protection or medicinal chemistry.

Formula: C₁₄H₂₀N₂O₃

InChI: InChI=1S/C14H20N2O3/c1-14(2,3)19-13(17)16-12(10-15-18)9-11-7-5-4-6-8-11/h4-8,10,12,18H,9H2,1-3H3,(H,16,17)

InChI key: InChIKey=OLINQFXDWRSOSY-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(NC(OC(C)(C)C)=O)C=NO

Synonyms:

• Carbamic acid, N-[1-[(hydroxyimino)methyl]-2-phenylethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-[(hydroxyimino)methyl]-2-phenylethyl]carbamate

TERT-BUTYL 1-(HYDROXYIMINO)-3-PHENYLPROPAN-2-YLCARBAMATE

CAS: 1033194-57-8

Formula: C₁₄H₂₀N₂O₃

Purity: 95.0%

Molecular weight: 264.325

Ref: 10-F306271