CAS 1033194-63-6

5-(Cyclopropylmethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzoic acid

Description:

5-(Cyclopropylmethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzoic acid is a complex organic compound characterized by its unique structural features, which include a benzoic acid moiety, a cyclopropylmethoxy group, and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis and other organic synthesis applications due to its ability to protect amino groups during reactions. The presence of the cyclopropyl group contributes to its steric properties, while the Fmoc group allows for selective deprotection under mild conditions, making it valuable in the field of medicinal chemistry and drug development. The compound's solubility and reactivity can vary depending on the solvent and conditions used, and it may exhibit specific interactions with biological targets, which can be explored in pharmacological studies. Overall, its structural complexity and functional groups make it a significant compound in synthetic organic chemistry.

Formula: C₂₆H₂₃NO₅

InChI: InChI=1S/C26H23NO5/c28-25(29)22-13-17(31-14-16-9-10-16)11-12-24(22)27-26(30)32-15-23-20-7-3-1-5-18(20)19-6-2-4-8-21(19)23/h1-8,11-13,16,23H,9-10,14-15H2,(H,27,30)(H,28,29)

InChI key: InChIKey=MZKGSCVYSMCBBD-UHFFFAOYSA-N

SMILES: C(OC(NC1=C(C(O)=O)C=C(OCC2CC2)C=C1)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4

Synonyms:

• 5-(Cyclopropylmethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzoic acid
• Benzoic acid, 5-(cyclopropylmethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-