CAS 1033202-54-8

1-(2-Bromo-5-fluoro-3-pyridinyl)ethanone

Description:

1-(2-Bromo-5-fluoro-3-pyridinyl)ethanone is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with bromine and fluorine atoms. The presence of these halogens contributes to its reactivity and potential applications in various chemical reactions. The ethanone functional group indicates that the compound contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical behavior, particularly in nucleophilic addition reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular weight, solubility, and stability under various conditions are important factors for its practical applications. Additionally, the compound's synthesis and purification methods are crucial for obtaining it in a usable form for research or industrial purposes. Overall, 1-(2-Bromo-5-fluoro-3-pyridinyl)ethanone represents a versatile building block in organic synthesis and may have implications in the development of pharmaceuticals or agrochemicals.

Formula: C₇H₅BrFNO

InChI: InChI=1S/C7H5BrFNO/c1-4(11)6-2-5(9)3-10-7(6)8/h2-3H,1H3

InChI key: InChIKey=IZNZGABMTQWKFJ-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(Br)N=CC(F)=C1

Synonyms:

• Ethanone, 1-(2-bromo-5-fluoro-3-pyridinyl)-
• 1-(2-Bromo-5-fluoro-3-pyridinyl)ethanone