CymitQuimica logo

CAS 1033203-28-9

:

5-(Bromomethyl)-2-pyridinamine

Description:
5-(Bromomethyl)-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group (-CH2Br) at the 5-position of the pyridine ring and an amino group (-NH2) at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents due to the amino group, while the bromomethyl group can serve as a reactive site for further chemical modifications. Its structure suggests potential use in medicinal chemistry, particularly in the development of pharmaceuticals, as the functional groups can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as brominated compounds can pose health risks, and appropriate handling and disposal procedures should be followed.
Formula:C6H7BrN2
InChI:InChI=1S/C6H7BrN2/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,3H2,(H2,8,9)
InChI key:InChIKey=KIAYQSNDVYAVKN-UHFFFAOYSA-N
SMILES:C(Br)C=1C=CC(N)=NC1
Synonyms:
  • 2-Pyridinamine, 5-(bromomethyl)-
  • 5-(Bromomethyl)-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.