CAS 1033203-37-0

2-Amino-5-methyl-4-pyridinemethanol

Description:

2-Amino-5-methyl-4-pyridinemethanol is an organic compound characterized by its pyridine ring structure, which features an amino group and a hydroxymethyl group. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its structure suggests potential applications in pharmaceuticals, particularly as a building block for drug synthesis or as an intermediate in organic synthesis. The presence of both amino and hydroxymethyl functionalities may also impart biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 2-Amino-5-methyl-4-pyridinemethanol is a versatile compound with potential utility in various chemical and pharmaceutical contexts.

Formula: C₇H₁₀N₂O

InChI: InChI=1S/C7H10N2O/c1-5-3-9-7(8)2-6(5)4-10/h2-3,10H,4H2,1H3,(H2,8,9)

InChI key: InChIKey=CMQMMKOZGHFYJM-UHFFFAOYSA-N

SMILES: C(O)C=1C(C)=CN=C(N)C1

Synonyms:

• 2-Amino-5-methyl-4-pyridinemethanol
• 4-Pyridinemethanol, 2-amino-5-methyl-
• (2-Amino-5-methylpyridin-4-yl)methanol