CAS 103321-57-9
:9H-Fluoren-9-ylmethyl N-[(1S)-2-chloro-2-oxo-1-(phenylmethyl)ethyl]carbamate
Description:
9H-Fluoren-9-ylmethyl N-[(1S)-2-chloro-2-oxo-1-(phenylmethyl)ethyl]carbamate, with the CAS number 103321-57-9, is a chemical compound characterized by its complex structure, which includes a fluorenylmethyl group and a carbamate moiety. This compound features a chiral center, contributing to its stereochemical properties, and contains a chloro and a carbonyl functional group, which can influence its reactivity and interactions in biological systems. The presence of the fluorenyl group often imparts unique photophysical properties, making it of interest in various applications, including medicinal chemistry and material science. Its potential biological activity may be attributed to the carbamate linkage, which is known to participate in enzyme inhibition and other biochemical interactions. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, making it essential to consider these factors in practical applications. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.
Formula:C24H20ClNO3
InChI:InChI=1S/C24H20ClNO3/c25-23(27)22(14-16-8-2-1-3-9-16)26-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,26,28)/t22-/m0/s1
InChI key:InChIKey=LRAXUKFFZHLNMX-QFIPXVFZSA-N
SMILES:C(OC(N[C@@H](CC1=CC=CC=C1)C(Cl)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- (S)-(9H-Fluoren-9-yl)methyl (1-chloro-1-oxo-3-phenylpropan-2-yl)carbamate
- 9H-Fluoren-9-ylmethyl N-[(1S)-2-chloro-2-oxo-1-(phenylmethyl)ethyl]carbamate
- 9H-fluoren-9-ylmethyl [(1S)-1-benzyl-2-chloro-2-oxoethyl]carbamate
- Carbamic acid, N-[(1S)-2-chloro-2-oxo-1-(phenylmethyl)ethyl]-, 9H-fluoren-9-ylmethyl ester
- Carbamic acid, [(1S)-2-chloro-2-oxo-1-(phenylmethyl)ethyl]-, 9H-fluoren-9-ylmethyl ester
- Carbamic acid, [2-chloro-2-oxo-1-(phenylmethyl)ethyl]-, 9H-fluoren-9-ylmethyl ester, (S)-
- Fmoc-Phe-Cl
- N-(9-Fluorenylmethoxycarbonyl)phenylalanyl chloride
- NALPHA-9-Fluorenylmethoxycarbonyl-L-phenylalanyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
