CAS 103321-60-4
:9H-Fluoren-9-ylmethyl N-[(1S)-2-chloro-2-oxo-1-[[4-(phenylmethoxy)phenyl]methyl]ethyl]carbamate
Description:
9H-Fluoren-9-ylmethyl N-[(1S)-2-chloro-2-oxo-1-[[4-(phenylmethoxy)phenyl]methyl]ethyl]carbamate, with CAS number 103321-60-4, is a synthetic organic compound characterized by its complex structure, which includes a fluorenylmethyl group and a carbamate moiety. This compound features a chiral center, contributing to its stereochemistry, and contains functional groups such as a chloro group and a carbonyl group, which may influence its reactivity and biological activity. The presence of the phenylmethoxy group suggests potential interactions with aromatic systems, which can enhance its solubility and stability in organic solvents. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis typically involves multi-step reactions, and it may be utilized in various applications, including drug development or as a biochemical probe. As with many synthetic compounds, understanding its properties, such as solubility, stability, and reactivity, is crucial for its practical applications in research and industry.
Formula:C31H26ClNO4
InChI:InChI=1S/C31H26ClNO4/c32-30(34)29(18-21-14-16-23(17-15-21)36-19-22-8-2-1-3-9-22)33-31(35)37-20-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28/h1-17,28-29H,18-20H2,(H,33,35)/t29-/m0/s1
InChI key:InChIKey=GKHIGWPLGJZONE-LJAQVGFWSA-N
SMILES:C(OC(N[C@@H](CC1=CC=C(OCC2=CC=CC=C2)C=C1)C(Cl)=O)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:- 9H-Fluoren-9-ylmethyl N-[(1S)-2-chloro-2-oxo-1-[[4-(phenylmethoxy)phenyl]methyl]ethyl]carbamate
- Carbamic acid, N-[(1S)-2-chloro-2-oxo-1-[[4-(phenylmethoxy)phenyl]methyl]ethyl]-, 9H-fluoren-9-ylmethyl ester
- Carbamic acid, [(1S)-2-chloro-2-oxo-1-[[4-(phenylmethoxy)phenyl]methyl]ethyl]-, 9H-fluoren-9-ylmethyl ester
- Carbamic acid, [2-chloro-2-oxo-1-[[4-(phenylmethoxy)phenyl]methyl]ethyl]-, 9H-fluoren-9-ylmethyl ester, (S)-
- Fmoc-Tyr(Bzl)-Cl
- NALPHA-9-Fluorenylmethoxycarbonyl-O-benzyl-L-tyrosyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.