CAS 103323-95-1

2-(Ethoxymethyl)benzoic acid

Description:

2-(Ethoxymethyl)benzoic acid is an organic compound characterized by its benzoic acid structure with an ethoxymethyl substituent at the ortho position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its ethoxy group enhances the compound's lipophilicity, which can influence its biological activity and interactions with other molecules. 2-(Ethoxymethyl)benzoic acid may be utilized in pharmaceutical applications, particularly in the synthesis of drug intermediates or as a building block in organic synthesis. Additionally, its unique structure may confer specific reactivity patterns, making it of interest in research and development within medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₁₂O₃

InChI: InChI=1S/C10H12O3/c1-2-13-7-8-5-3-4-6-9(8)10(11)12/h3-6H,2,7H2,1H3,(H,11,12)

InChI key: InChIKey=ATDOHRXCJDZRNJ-UHFFFAOYSA-N

SMILES: C(OCC)C1=C(C(O)=O)C=CC=C1

Synonyms:

• 2-(Ethoxymethyl)benzoic acid
• o-Toluic acid, α-ethoxy-
• Benzoic acid, 2-(ethoxymethyl)-