CymitQuimica logo

CAS 103330-20-7

:

Bisethoxycarbonylphenoxy]decane

Description:
Bisethoxycarbonylphenoxydecane, identified by its CAS number 103330-20-7, is a chemical compound characterized by its unique structure that includes both ethoxycarbonyl and phenoxy functional groups attached to a decane backbone. This compound typically exhibits properties associated with both hydrophobic and hydrophilic characteristics due to the presence of long hydrocarbon chains and polar functional groups. It may be soluble in organic solvents while showing limited solubility in water. The presence of the phenoxy group can impart specific reactivity and potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the ethoxycarbonyl groups may influence its reactivity, making it useful in various chemical reactions, including esterification and nucleophilic substitutions. Overall, Bisethoxycarbonylphenoxydecane is of interest in fields such as materials science, pharmaceuticals, and organic chemistry, where its unique properties can be leveraged for specific applications.
Formula:C28H38O6
InChI:InChI=1/C28H38O6/c1-3-31-27(29)23-13-17-25(18-14-23)33-21-11-9-7-5-6-8-10-12-22-34-26-19-15-24(16-20-26)28(30)32-4-2/h13-20H,3-12,21-22H2,1-2H3
SMILES:CCOC(=O)c1ccc(cc1)OCCCCCCCCCCOc1ccc(cc1)C(=O)OCC
Synonyms:
  • 1,10-Bis[4-(ethoxycarbonyl)phenoxy]decane
  • Diethyl 4,4'-[Decane-1,10-Diylbis(Oxy)]Dibenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.