CAS 103336-06-7
:(2S)-1-(tert-Butoxycarbonyl)-2-methylpyrrolidine-2-carboxylic acid
Description:
(2S)-1-(tert-Butoxycarbonyl)-2-methylpyrrolidine-2-carboxylic acid is a chiral compound characterized by its pyrrolidine ring structure, which includes a tert-butoxycarbonyl (Boc) protecting group and a carboxylic acid functional group. This compound is typically used in organic synthesis, particularly in the preparation of amino acids and peptides, due to its ability to protect amine functionalities during chemical reactions. The presence of the methyl group at the 2-position of the pyrrolidine ring contributes to its stereochemistry, influencing its reactivity and interactions in biological systems. The Boc group is commonly employed in peptide synthesis as it can be easily removed under mild acidic conditions, allowing for the selective deprotection of amines. Additionally, the compound's solubility and stability are influenced by its functional groups, making it suitable for various synthetic applications. Overall, this compound serves as an important intermediate in the field of medicinal chemistry and drug development.
Formula:C11H19NO4
InChI:InChI=1S/C11H19NO4/c1-10(2,3)16-9(15)12-7-5-6-11(12,4)8(13)14/h5-7H2,1-4H3,(H,13,14)/t11-/m0/s1
InChI key:InChIKey=YQXRKJHVAUKXRN-NSHDSACASA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@@](C(O)=O)(C)CCC1
Synonyms:- (2S)-1-(tert-Butoxycarbonyl)-2-methylpyrrolidine-2-carboxylic acid
- (2S)-1-[(tert-butoxy)carbonyl]-2-methylpyrrolidine-2-carboxylic acid
- (2S)-2-Methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
- (S)-1-(tert-Butoxycarbonyl)-2-methyl-2-pyrrolidinecarboxylic acid
- (S)-Boc-2-methylproline
- (S)-N-(tert-Butoxycarbonyl)-α-methylproline
- 1,2-Pyrrolidinedicarboxylic acid, 2-methyl-, 1-(1,1-dimethylethyl) ester, (2S)-
- 1,2-Pyrrolidinedicarboxylic acid, 2-methyl-, 1-(1,1-dimethylethyl) ester, (S)-
- Boc-α-Methyl-<span class="text-smallcaps">L</span>-Proline
- N-Boc-A-Methyl-L-Proline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Pyrrolidinedicarboxylic acid, 2-methyl-, 1-(1,1-dimethylethyl) ester,(2S)-
CAS:Formula:C11H19NO4Purity:97%Color and Shape:SolidMolecular weight:229.27291-(tert-butoxycarbonyl)-2-methyl-L-proline
CAS:Formula:C11H19NO4Purity:95%Color and Shape:Solid, CrystallineMolecular weight:229.276N-Boc-2-methyl-L-proline
CAS:N-Boc-2-methyl-L-proline is a chemical compound that is used as a building block in the synthesis of other compounds. This substance is also an intermediate in the production of pharmaceuticals and pesticides. The compound has been shown to have high quality, versatility, and complexity. N-Boc-2-methyl-L-proline can be used as a reagent for research or as a speciality chemical. The CAS number for this substance is 103336-06-7.Formula:C11H19NO4Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:229.27 g/mol





