CAS 103340-16-5

Boc-Phe-Gly-Gly-OH

Description:

Boc-Phe-Gly-Gly-OH, also known as Boc-Phenylalanine-Glycine-Glycine-OH, is a peptide derivative characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the phenylalanine (Phe) residue. This compound features a sequence of amino acids, specifically phenylalanine followed by two glycine residues. The Boc group is commonly used in peptide synthesis to protect the amino group of the amino acid, allowing for selective reactions without interference from the amine. The presence of glycine, a non-polar amino acid, contributes to the overall hydrophilicity and flexibility of the peptide. This compound is typically utilized in biochemical research and peptide synthesis, particularly in the development of pharmaceuticals and in studies involving peptide interactions. Its stability and solubility in various solvents make it suitable for various applications in organic and medicinal chemistry. As with many peptides, its properties can be influenced by factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₈H₂₅N₃O₆

InChI: InChI=1/C18H25N3O6/c1-18(2,3)27-17(26)21-13(9-12-7-5-4-6-8-12)16(25)20-10-14(22)19-11-15(23)24/h4-8,13H,9-11H2,1-3H3,(H,19,22)(H,20,25)(H,21,26)(H,23,24)

SMILES: CC(C)(C)OC(=NC(Cc1ccccc1)C(=NCC(=NCC(=O)O)O)O)O

Synonyms:

• N-(tert-butoxycarbonyl)phenylalanylglycylglycine

Boc-Phe-Gly-Gly-OH

CAS: 103340-16-5

Formula: C₁₈H₂₅N₃O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 379.4076

Ref: IN-DA008UVI

(Tert-butoxycarbonyl)-L-phenylalanylglycylglycine

CAS: 103340-16-5

(Tert-butoxycarbonyl)-L-phenylalanylglycylglycine

Purity: 97%

Molecular weight: 379.41g/mol

Ref: 54-OR1002016

Boc-Phe-Gly-Gly-OH

CAS: 103340-16-5

Purity: 97%

Molecular weight: 379.174

Ref: 10-F765600

Boc-Phe-Gly-Gly-OH

CAS: 103340-16-5

Boc-Phe-Gly-Gly-OH is a peptide that can be used in the synthesis of peptides. It has reactive moieties and is a carboxylic acid with an aromatic amino group. Boc-Phe-Gly-Gly-OH is a site-specific catalyst that reacts with hydroxyl groups on the ligation side to form amide bonds. The catalytic mechanism of this compound involves a nucleophilic attack by the carbonyl oxygen atom on the electrophilic carbon atom, forming an intermediate iminium ion. This intermediate then tautomerizes to give the desired product and CO2.

Formula: C₁₈H₂₅N₃O₆

Purity: Min. 95%

Molecular weight: 379.41 g/mol

Ref: 3D-FB111238