
CAS 1033434-55-7
:3-Bromo-2-methylimidazo[1,2-a]pyridine-8-carboxaldehyde
Description:
3-Bromo-2-methylimidazo[1,2-a]pyridine-8-carboxaldehyde is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. The presence of a bromine atom at the 3-position and a carboxaldehyde functional group at the 8-position contributes to its reactivity and potential biological activity. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the electrophilic nature of the aldehyde group. Additionally, compounds of this class are of interest in medicinal chemistry, particularly for their potential roles in biological systems and as precursors in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C9H7BrN2O
InChI:InChI=1S/C9H7BrN2O/c1-6-8(10)12-4-2-3-7(5-13)9(12)11-6/h2-5H,1H3
InChI key:InChIKey=UMERLIUUWNEKDQ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2N(C(Br)=C(C)N2)C=CC1
Synonyms:- 3-Bromo-2-methylimidazo[1,2-a]pyridine-8-carbaldehyde
- Imidazo[1,2-a]pyridine-8-carboxaldehyde, 3-bromo-2-methyl-
- 3-Bromo-2-methylimidazo[1,2-a]pyridine-8-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.