CAS 1033463-18-1

1-[4-(4-Chlorophenyl)-2-thiazolyl]-N-(2-hydroxyethyl)-4-piperidinecarboxamide

Description:

1-[4-(4-Chlorophenyl)-2-thiazolyl]-N-(2-hydroxyethyl)-4-piperidinecarboxamide, with CAS number 1033463-18-1, is a chemical compound characterized by its complex structure, which includes a thiazole ring, a piperidine moiety, and a chlorophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its interaction with biological targets. Additionally, the thiazole and piperidine components may contribute to its pharmacological profile, potentially affecting its efficacy and safety in therapeutic applications. The chlorophenyl substituent can also impact the compound's lipophilicity and overall reactivity. As with many synthetic organic compounds, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its characteristics and potential applications in medicinal chemistry.

Formula: C₁₇H₂₀ClN₃O₂S

InChI: InChI=1S/C17H20ClN3O2S/c18-14-3-1-12(2-4-14)15-11-24-17(20-15)21-8-5-13(6-9-21)16(23)19-7-10-22/h1-4,11,13,22H,5-10H2,(H,19,23)

InChI key: InChIKey=YPTWJMUXOHIAEV-UHFFFAOYSA-N

SMILES: C(NCCO)(=O)C1CCN(C2=NC(=CS2)C3=CC=C(Cl)C=C3)CC1

Synonyms:

• 1-[4-(4-Chlorophenyl)-2-thiazolyl]-N-(2-hydroxyethyl)-4-piperidinecarboxamide
• 4-Piperidinecarboxamide, 1-[4-(4-chlorophenyl)-2-thiazolyl]-N-(2-hydroxyethyl)-