CymitQuimica logo

CAS 1033463-19-2

:

N-[2,4-Dichloro-5-[(4-nitrophenyl)methoxy]phenyl]acetamide

Description:
N-[2,4-Dichloro-5-[(4-nitrophenyl)methoxy]phenyl]acetamide, identified by its CAS number 1033463-19-2, is a synthetic organic compound characterized by its complex aromatic structure. This compound features a dichlorophenyl moiety, which contributes to its potential biological activity, and a nitrophenyl group that enhances its electronic properties. The presence of the acetamide functional group suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals or agrochemicals, often exhibiting properties such as antimicrobial or herbicidal activity. The specific arrangement of substituents on the phenyl rings can significantly affect the compound's interaction with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the presence of chlorine and nitro groups may impart unique chemical reactivity, allowing for further derivatization or modification in synthetic pathways. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.
Formula:C15H12Cl2N2O4
InChI:InChI=1S/C15H12Cl2N2O4/c1-9(20)18-14-7-15(13(17)6-12(14)16)23-8-10-2-4-11(5-3-10)19(21)22/h2-7H,8H2,1H3,(H,18,20)
InChI key:InChIKey=HBKZWJNBWLBBBP-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(N(=O)=O)C=C1)C2=CC(NC(C)=O)=C(Cl)C=C2Cl
Synonyms:
  • Acetamide, N-[2,4-dichloro-5-[(4-nitrophenyl)methoxy]phenyl]-
  • N-[2,4-Dichloro-5-[(4-nitrophenyl)methoxy]phenyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.