CAS 1033463-25-0
:5-Amino-1-(2-benzoxazolyl)-2,3-dihydro-1H-pyrazole-4-carbonitrile
Description:
5-Amino-1-(2-benzoxazolyl)-2,3-dihydro-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrazole ring, an amino group, and a benzoxazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the carbonitrile group suggests it may participate in nucleophilic reactions, while the benzoxazole ring can contribute to its aromatic stability and potential interactions with biological targets. The compound's molecular structure may allow for hydrogen bonding and π-π stacking interactions, which are relevant in drug design and development. Additionally, the presence of the amino group can enhance its reactivity and solubility in biological systems. Overall, this compound's unique features make it a candidate for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H9N5O
InChI:InChI=1S/C11H9N5O/c12-5-7-6-14-16(10(7)13)11-15-8-3-1-2-4-9(8)17-11/h1-4,14H,6,13H2
InChI key:InChIKey=DVCKMBGSVVAYCZ-UHFFFAOYSA-N
SMILES:NC=1N(C2=NC=3C(O2)=CC=CC3)NCC1C#N
Synonyms:- 1H-Pyrazole-4-carbonitrile, 5-amino-1-(2-benzoxazolyl)-2,3-dihydro-
- 5-Amino-1-(2-benzoxazolyl)-2,3-dihydro-1H-pyrazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.