CAS 1033463-27-2

6,8-Dichloro-3-iodoimidazo[1,2-a]pyridine

Description:

6,8-Dichloro-3-iodoimidazo[1,2-a]pyridine is a heterocyclic compound characterized by its imidazo[1,2-a]pyridine core, which incorporates both chlorine and iodine substituents. This compound features two chlorine atoms located at the 6 and 8 positions and an iodine atom at the 3 position of the imidazo ring. The presence of these halogen substituents can significantly influence the compound's chemical reactivity, solubility, and biological activity. Typically, such compounds exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The imidazo[1,2-a]pyridine framework is known for its potential applications in drug development, particularly in targeting various biological pathways. Additionally, the compound's molecular structure may contribute to its stability and interaction with biological targets. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application. Overall, 6,8-Dichloro-3-iodoimidazo[1,2-a]pyridine represents a unique structure with potential utility in various chemical and pharmaceutical contexts.

Formula: C₇H₃Cl₂IN₂

InChI: InChI=1S/C7H3Cl2IN2/c8-4-1-5(9)7-11-2-6(10)12(7)3-4/h1-3H

InChI key: InChIKey=SGUPSXOQJZJCOX-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C=C(Cl)C1)C(I)=CN2

Synonyms:

• Imidazo[1,2-a]pyridine, 6,8-dichloro-3-iodo-
• 6,8-Dichloro-3-iodoimidazo[1,2-a]pyridine