CymitQuimica logo

CAS 1033463-38-5

:

2-[4-(Hydroxymethyl)-1-piperidinyl]-5-nitrobenzaldehyde

Description:
2-[4-(Hydroxymethyl)-1-piperidinyl]-5-nitrobenzaldehyde, with the CAS number 1033463-38-5, is an organic compound characterized by its complex structure, which includes a nitro group, an aldehyde functional group, and a piperidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the benzaldehyde moiety and the piperidine ring. The hydroxymethyl group contributes to its potential reactivity, making it a candidate for various chemical transformations. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. In terms of solubility, compounds of this nature often show varying degrees of solubility in polar and non-polar solvents, depending on the balance of hydrophilic and hydrophobic characteristics. Additionally, the presence of functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may serve as intermediates or active pharmaceutical ingredients.
Formula:C13H16N2O4
InChI:InChI=1S/C13H16N2O4/c16-8-10-3-5-14(6-4-10)13-2-1-12(15(18)19)7-11(13)9-17/h1-2,7,9-10,16H,3-6,8H2
InChI key:InChIKey=BGKFVXZIUPQNKM-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC(N(=O)=O)=C1)N2CCC(CO)CC2
Synonyms:
  • 2-[4-(Hydroxymethyl)-1-piperidinyl]-5-nitrobenzaldehyde
  • Benzaldehyde, 2-[4-(hydroxymethyl)-1-piperidinyl]-5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.