CAS 1033463-44-3

3-(4-Bromophenyl)-5,6-dihydroimidazo[2,1-b]thiazole-2-carboxaldehyde

Description:

3-(4-Bromophenyl)-5,6-dihydroimidazo[2,1-b]thiazole-2-carboxaldehyde is a heterocyclic organic compound characterized by its complex structure, which includes an imidazole ring fused with a thiazole moiety. The presence of a bromophenyl group enhances its aromatic properties and may influence its reactivity and biological activity. This compound features a carboxaldehyde functional group, which is known for its reactivity in various chemical reactions, including condensation and oxidation. The imidazo-thiazole framework is of particular interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. The bromine substituent can also modulate the electronic properties of the molecule, potentially affecting its interactions with biological targets. Overall, this compound exemplifies the diverse chemistry of heterocycles and their applications in drug discovery and development. Its specific characteristics, such as solubility, melting point, and spectral data, would require experimental determination or literature reference for precise values.

Formula: C₁₂H₉BrN₂OS

InChI: InChI=1S/C12H9BrN2OS/c13-9-3-1-8(2-4-9)11-10(7-16)17-12-14-5-6-15(11)12/h1-4,7H,5-6H2

InChI key: InChIKey=VTPZUJMJQSIVLZ-UHFFFAOYSA-N

SMILES: C(=O)C1=C(N2C(S1)=NCC2)C3=CC=C(Br)C=C3

Synonyms:

• Imidazo[2,1-b]thiazole-2-carboxaldehyde, 3-(4-bromophenyl)-5,6-dihydro-
• 3-(4-Bromophenyl)-5,6-dihydroimidazo[2,1-b]thiazole-2-carboxaldehyde