
CAS 10335-81-6
:N-Hydroxy-3-methylbenzamide
Description:
N-Hydroxy-3-methylbenzamide, with the CAS number 10335-81-6, is an organic compound characterized by the presence of a hydroxylamine functional group attached to a 3-methylbenzamide structure. This compound typically appears as a solid or crystalline substance and is known for its role in various chemical reactions, particularly in organic synthesis and as a reagent in the preparation of other chemical entities. The presence of the hydroxylamine group imparts unique reactivity, allowing it to participate in nucleophilic reactions and serve as a potential intermediate in the synthesis of pharmaceuticals and agrochemicals. Its molecular structure contributes to its solubility properties, often making it soluble in polar solvents. Additionally, N-hydroxy compounds are often studied for their biological activities, including potential antioxidant properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-6-3-2-4-7(5-6)8(10)9-11/h2-5,11H,1H3,(H,9,10)
InChI key:InChIKey=HMIQPPRQWABYPJ-UHFFFAOYSA-N
SMILES:C(NO)(=O)C1=CC(C)=CC=C1
Synonyms:- m-Toluohydroxamic acid
- N-Hydroxy-3-methylbenzamide
- m-Methylbenzhydroxamic acid
- m-Toluhydroxamic acid
- Benzamide, N-hydroxy-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.