CymitQuimica logo

CAS 1033600-04-2

:

1-[(2-Fluorophenyl)methyl]-3-oxo-2-piperazineacetic acid

Description:
1-[(2-Fluorophenyl)methyl]-3-oxo-2-piperazineacetic acid is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. The "3-oxo" functional group suggests the presence of a ketone, contributing to the compound's reactivity and stability. Additionally, the acetic acid moiety indicates that the compound has acidic properties, which may affect its solubility and interaction with biological systems. This compound may exhibit pharmacological activities, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and biological activity, would depend on its molecular structure and the interactions of its functional groups. Overall, this compound represents a unique structure that could be explored for various applications in drug development and research.
Formula:C13H15FN2O3
InChI:InChI=1S/C13H15FN2O3/c14-10-4-2-1-3-9(10)8-16-6-5-15-13(19)11(16)7-12(17)18/h1-4,11H,5-8H2,(H,15,19)(H,17,18)
InChI key:InChIKey=ZAWDHYRVWWFEOT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1N(CC2=C(F)C=CC=C2)CCNC1=O
Synonyms:
  • 2-Piperazineacetic acid, 1-[(2-fluorophenyl)methyl]-3-oxo-
  • 1-[(2-Fluorophenyl)methyl]-3-oxo-2-piperazineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.