
CAS 103362-08-9
:7-Fluoro-2-methyl-2H-1,4-benzoxazin-3(4H)-one
Description:
7-Fluoro-2-methyl-2H-1,4-benzoxazin-3(4H)-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring system. This compound features a fluorine atom at the 7-position and a methyl group at the 2-position of the benzoxazine moiety. It is known for its potential applications in various fields, including medicinal chemistry and agrochemicals, due to its biological activity. The presence of the fluorine atom can enhance the compound's lipophilicity and metabolic stability, making it an interesting candidate for drug development. Additionally, the benzoxazine structure is associated with a range of pharmacological properties, including anti-inflammatory and antimicrobial activities. The compound is typically synthesized through specific organic reactions that involve the formation of the benzoxazine ring. As with many chemical substances, safety and handling precautions should be observed, as it may exhibit toxicity or other hazardous properties. Overall, 7-Fluoro-2-methyl-2H-1,4-benzoxazin-3(4H)-one represents a significant area of interest in chemical research and development.
Formula:C9H8FNO2
InChI:InChI=1S/C9H8FNO2/c1-5-9(12)11-7-3-2-6(10)4-8(7)13-5/h2-5H,1H3,(H,11,12)
InChI key:InChIKey=OVLYPEDRBXIAGN-UHFFFAOYSA-N
SMILES:CC1OC=2C(NC1=O)=CC=C(F)C2
Synonyms:- 2-Methyl-3-oxo-7-fluoro-3,4-dihydro-2H-benzo[b][1,4]oxazine
- 2H-1,4-Benzoxazin-3(4H)-one, 7-fluoro-2-methyl-
- 7-Fluoro-2-methyl-2H-1,4-benzoxazin-3(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.