CAS 103365-47-5
:(S)-N-BOC-3-Amino-3-phenylpropanoic acid
Description:
(S)-N-BOC-3-Amino-3-phenylpropanoic acid is a chiral amino acid derivative characterized by the presence of a tert-butyloxycarbonyl (BOC) protecting group on the amino group, which enhances its stability and solubility in organic solvents. This compound features a phenyl group attached to the central carbon, contributing to its hydrophobic characteristics. The presence of the carboxylic acid functional group allows for potential reactivity in peptide synthesis and other organic reactions. As a chiral molecule, it exists in two enantiomeric forms, with the (S) configuration being of particular interest in pharmaceutical applications due to its biological activity. The compound is typically used in the synthesis of peptides and other biologically active molecules, making it valuable in medicinal chemistry. Its physical properties, such as melting point and solubility, can vary based on the solvent and conditions used. Overall, (S)-N-BOC-3-Amino-3-phenylpropanoic acid serves as an important intermediate in organic synthesis and drug development.
Formula:C14H18NO4
InChI:InChI=1/C14H19NO4/c1-14(2,3)19-13(18)15-11(9-12(16)17)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/p-1/t11-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CC(=O)[O-])c1ccccc1)O
Synonyms:- (S)-N-BOC-beta-phenyl-beta-alanine
- (S)-N-tert-Butoxycarbonyl-3-amino-3-phenylpropanoic acid
- Boc-L-3-3-Amino-3-phenylpropionic acid
- (3S)-3-[(tert-butoxycarbonyl)amino]-3-phenylpropanoic acid
- 3-[(Tert-Butoxycarbonyl)Amino]-3-Phenylpropanoic Acid
- (3S)-3-[(tert-butoxycarbonyl)amino]-3-phenylpropanoate
- Boc-S-3-Amino-3-phenylpropionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-3-(Boc-amino)-3-phenylpropionic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C14H18NO4Purity:95%Color and Shape:Powder, White to off-whiteMolecular weight:264.30(S)-N-Boc-3-Amino-3-phenylpropanoic acid
CAS:Formula:C14H19NO4Purity:97%Color and Shape:SolidMolecular weight:265.3050(S)-3-N-Boc-Amino-β-phenylalanine
CAS:Formula:C14H19NO4Purity:97%Color and Shape:SolidMolecular weight:265.309




