CAS 103368-21-4

(4-methyl-2-oxoquinolin-1(2H)-yl)acetic acid

Description:

(4-Methyl-2-oxoquinolin-1(2H)-yl)acetic acid is a chemical compound characterized by its quinoline structure, which features a methyl group and a ketone functional group at specific positions on the ring. This compound is classified as an amino acid derivative due to the presence of the acetic acid moiety. It exhibits properties typical of both quinoline derivatives and carboxylic acids, including potential biological activity, which may be of interest in pharmaceutical research. The presence of the ketone and carboxylic acid functional groups suggests that it may participate in various chemical reactions, such as esterification or amidation. Additionally, the compound may exhibit solubility in polar solvents, which is common for carboxylic acids. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, (4-methyl-2-oxoquinolin-1(2H)-yl)acetic acid represents a unique combination of structural features that may confer interesting chemical and biological properties.

Formula: C₁₂H₁₁NO₃

InChI: InChI=1/C12H11NO3/c1-8-6-11(14)13(7-12(15)16)10-5-3-2-4-9(8)10/h2-6H,7H2,1H3,(H,15,16)

SMILES: Cc1cc(=O)n(CC(=O)O)c2ccccc12

Synonyms:

• 1(2H)-quinolineacetic acid, 4-methyl-2-oxo-