CAS 1033693-04-7

1-(3-Aminophenyl)-5-methyl-2-pyrrolidinone

Description:

1-(3-Aminophenyl)-5-methyl-2-pyrrolidinone, identified by its CAS number 1033693-04-7, is an organic compound characterized by its unique structure that includes a pyrrolidinone ring and an amino-substituted phenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of both hydrophobic and hydrophilic regions in its molecular structure. The amino group contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methyl group on the pyrrolidinone ring may influence its steric properties and overall reactivity. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would need to be referenced from experimental studies or databases for precise characterization.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1S/C11H14N2O/c1-8-5-6-11(14)13(8)10-4-2-3-9(12)7-10/h2-4,7-8H,5-6,12H2,1H3

InChI key: InChIKey=HSOSVRQUSPTFGY-UHFFFAOYSA-N

SMILES: CC1N(C2=CC(N)=CC=C2)C(=O)CC1

Synonyms:

• 2-Pyrrolidinone, 1-(3-aminophenyl)-5-methyl-
• 1-(3-Aminophenyl)-5-methyl-2-pyrrolidinone