
CAS 1033710-19-8
:trans-3-(Methylamino)cyclobutanol
Description:
Trans-3-(Methylamino)cyclobutanol is a cyclic organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a methylamino group (-NH(CH3)2) at the 3-position of the cyclobutane contributes to its unique chemical properties, including potential basicity and reactivity due to the amino group. This compound is likely to exhibit chirality, as the cyclobutane ring can create stereocenters, leading to different enantiomers. The hydroxyl group (-OH) indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility in polar solvents. The trans configuration suggests that the substituents on the cyclobutane are positioned opposite each other, which can affect the compound's three-dimensional shape and reactivity. Overall, trans-3-(Methylamino)cyclobutanol may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation.
Formula:C5H11NO
InChI:InChI=1/C5H11NO/c1-6-4-2-5(7)3-4/h4-7H,2-3H2,1H3/t4-,5-
InChI key:InChIKey=DRLQGNZKHKBJFA-URHBZAFANA-N
SMILES:N(C)[C@H]1C[C@H](O)C1
Synonyms:- 3-trans-(Methylamino)cyclobutanol
- trans-3-(Methylamino)cyclobutanol
- Cyclobutanol, 3-(methylamino)-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.