
CAS 1033715-40-0
:2-(3-Thienyl)-1H-imidazole
Description:
2-(3-Thienyl)-1H-imidazole is a heterocyclic organic compound characterized by the presence of both an imidazole ring and a thienyl group. The imidazole portion consists of a five-membered ring containing two nitrogen atoms, which contributes to its basicity and potential for coordination with metal ions. The thienyl group, derived from thiophene, introduces sulfur into the structure, enhancing its electronic properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of novel drugs or as a building block in organic synthesis. The presence of both nitrogen and sulfur atoms can also influence its biological activity, making it a subject of interest in medicinal chemistry. As with many heterocycles, the compound may exhibit interesting optical and electronic properties, which can be explored for various applications in organic electronics or sensors.
Formula:C7H6N2S
InChI:InChI=1S/C7H6N2S/c1-4-10-5-6(1)7-8-2-3-9-7/h1-5H,(H,8,9)
InChI key:InChIKey=LCRYNZVBZZAJCE-UHFFFAOYSA-N
SMILES:C=1(C=CSC1)C=2NC=CN2
Synonyms:- 1H-Imidazole, 2-(3-thienyl)-
- 2-(Thiophen-3-yl)-1H-imidazole
- 2-(3-Thienyl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.