CAS 1033760-76-7

B-(4′-Chloro-4-methyl[1,1′-biphenyl]-3-yl)boronic acid

Description:

B-(4′-Chloro-4-methyl[1,1′-biphenyl]-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a biphenyl structure with a chlorine atom and a methyl group attached to the aromatic ring, contributing to its unique electronic and steric properties. The presence of the boronic acid moiety allows for participation in cross-coupling reactions, such as Suzuki-Miyaura coupling, making it valuable in the synthesis of complex organic molecules. Additionally, the chlorine substituent can influence the reactivity and solubility of the compound, while the methyl group may affect its steric hindrance. Overall, this compound is significant in the development of pharmaceuticals and materials science due to its versatile reactivity and functionalization potential.

Formula: C₁₃H₁₂BClO₂

InChI: InChI=1S/C13H12BClO2/c1-9-2-3-11(8-13(9)14(16)17)10-4-6-12(15)7-5-10/h2-8,16-17H,1H3

InChI key: InChIKey=OQOROWVUCZFDNU-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(C=CC1C)C2=CC=C(Cl)C=C2

Synonyms:

• Boronic acid, B-(4′-chloro-4-methyl[1,1′-biphenyl]-3-yl)-
• B-(4′-Chloro-4-methyl[1,1′-biphenyl]-3-yl)boronic acid
• [5-(4-Chlorophenyl)-2-methylphenyl]boronic acid

Boronic acid, B-(4′-chloro-4-methyl[1,1′-biphenyl]-3-yl)-

CAS: 1033760-76-7

Formula: C₁₃H₁₂BClO₂

Purity: >95%

Molecular weight: 246.4972

Ref: IN-DA01RQB4