
CAS 1033772-24-5
:1H-Pyrazolo[4,3-b]pyridine-5-methanol
Description:
1H-Pyrazolo[4,3-b]pyridine-5-methanol is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a pyrazole ring fused to a pyridine ring, with a hydroxymethyl group (-CH2OH) attached at the 5-position of the pyrazole. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the hydroxymethyl group can influence its solubility and reactivity, potentially enhancing its interactions with biological targets. The compound may exhibit various properties, including moderate polarity and the ability to participate in hydrogen bonding due to the hydroxyl group. Its unique structure allows for potential applications in drug development, particularly in the search for new therapeutic agents. As with many heterocycles, the compound's stability and reactivity can be influenced by the electronic properties of the nitrogen atoms in the rings. Overall, 1H-Pyrazolo[4,3-b]pyridine-5-methanol represents a class of compounds that may offer valuable insights into pharmacological research.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c11-4-5-1-2-6-7(9-5)3-8-10-6/h1-3,11H,4H2,(H,8,10)
InChI key:InChIKey=XFINYYUXBHQDHL-UHFFFAOYSA-N
SMILES:C(O)C=1N=C2C(=CC1)NN=C2
Synonyms:- 1H-Pyrazolo[4,3-b]pyridine-5-methanol
- 1H-Pyrazolo[4,3-b]pyridin-5-ylmethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.