CymitQuimica logo

CAS 1033772-25-6

:

5-Iodo-1H-pyrazolo[3,4-c]pyridine

Description:
5-Iodo-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, with an iodine substituent at the 5-position of the pyrazole ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the iodine atom can enhance the compound's reactivity and influence its pharmacokinetic properties. Additionally, 5-Iodo-1H-pyrazolo[3,4-c]pyridine may exhibit various chemical properties, such as the ability to participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the iodine atom. Its unique structure allows for potential interactions with biological targets, which may lead to applications in treating various diseases. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH.
Formula:C6H4IN3
InChI:InChI=1S/C6H4IN3/c7-6-1-4-2-9-10-5(4)3-8-6/h1-3H,(H,9,10)
InChI key:InChIKey=VTXOKWFPIHACCH-UHFFFAOYSA-N
SMILES:IC=1C=C2C(=CN1)NN=C2
Synonyms:
  • 1H-Pyrazolo[3,4-c]pyridine, 5-iodo-
  • 5-Iodo-1H-pyrazolo[3,4-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.