CAS 1033810-72-8

7-(Phenylmethoxy)[1,2,4]triazolo[1,5-a]pyridine

Description:

7-(Phenylmethoxy)[1,2,4]triazolo[1,5-a]pyridine is a chemical compound characterized by its unique triazole and pyridine ring structures, which contribute to its potential biological activity. The presence of the phenylmethoxy group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in pharmaceutical research. Its molecular structure allows for various functionalizations, which can be explored to optimize its efficacy and selectivity in biological applications. Additionally, the compound's stability and solubility in different solvents can affect its practical use in laboratory and industrial settings. As with many heterocyclic compounds, the specific arrangement of atoms and functional groups plays a crucial role in determining its reactivity and interaction with other molecules. Further studies, including in vitro and in vivo evaluations, are essential to fully understand its pharmacological potential and mechanisms of action.

Formula: C₁₃H₁₁N₃O

InChI: InChI=1S/C13H11N3O/c1-2-4-11(5-3-1)9-17-12-6-7-16-13(8-12)14-10-15-16/h1-8,10H,9H2

InChI key: InChIKey=ZCUJWYCESPCMBB-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=CC=3N(C=C2)N=CN3

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyridine, 7-(phenylmethoxy)-
• 7-Benzyloxy-[1,2,4]triazolo[1,5-a]pyridine
• 7-(Phenylmethoxy)[1,2,4]triazolo[1,5-a]pyridine