CymitQuimica logo

CAS 10339-02-3

:

1-Chloro-N,N,N′,N′,1-pentamethylsilanediamine

Description:
1-Chloro-N,N,N′,N′,1-pentamethylsilanediamine, with the CAS number 10339-02-3, is an organosilicon compound characterized by the presence of a chlorine atom and a pentamethylsilanediamine structure. This compound features a silicon atom bonded to five methyl groups and two amine groups, which are further substituted with a chlorine atom. The presence of the chlorine atom introduces reactivity, making it useful in various chemical applications, including as a reagent in organic synthesis. The pentamethylsilanediamine framework contributes to its unique properties, such as enhanced solubility in organic solvents and potential applications in materials science and catalysis. Additionally, the steric bulk provided by the methyl groups can influence the compound's reactivity and interaction with other molecules. Overall, 1-Chloro-N,N,N′,N′,1-pentamethylsilanediamine is notable for its distinctive structure and potential utility in synthetic chemistry.
Formula:C5H15ClN2Si
InChI:InChI=1S/C5H15ClN2Si/c1-7(2)9(5,6)8(3)4/h1-5H3
InChI key:InChIKey=BZHQCJMLAYVPCL-UHFFFAOYSA-N
SMILES:[Si](N(C)C)(N(C)C)(C)Cl
Synonyms:
  • 1-Chloro-N,N,N′,N′,1-pentamethylsilanediamine
  • Chlorobis(dimethylamino)methylsilane
  • Bis(dimethylamino)methylchlorosilane
  • Silanediamine, 1-chloro-N,N,N′,N′,1-pentamethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.