CAS 1033906-60-3
:2,2-Difluoroethanesulfonyl chloride
Description:
2,2-Difluoroethanesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features two fluorine atoms attached to the ethane backbone, which can influence its reactivity and polarity. It is typically a colorless to pale yellow liquid at room temperature and has a pungent odor, typical of sulfonyl chlorides. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in various nucleophilic substitution reactions. This compound is often used in the synthesis of pharmaceuticals and agrochemicals, as well as in the preparation of sulfonamide derivatives. Due to its reactive nature, it should be handled with care, as it can react vigorously with water and other nucleophiles, releasing hydrochloric acid and potentially hazardous byproducts. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance.
Formula:C2H3ClF2O2S
InChI:InChI=1S/C2H3ClF2O2S/c3-8(6,7)1-2(4)5/h2H,1H2
InChI key:InChIKey=WTNIHKYYNJGJRA-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C(F)F
Synonyms:- 2,2-Difluoroethanesulfonyl chloride
- 2,2-Difluoroethane-1-sulfonyl chloride
- Ethanesulfonyl chloride, 2,2-difluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2-Difluoroethanesulfonyl chloride
CAS:2,2-Difluoroethanesulfonyl chloridePurity:≥95%Molecular weight:164.56g/mol2,2-Difluoroethanesulfonyl chloride
CAS:2,2-Difluoroethanesulfonyl chloride is a versatile building block that can be used in the synthesis of complex compounds. It is an intermediate for research chemicals and reagents, as well as a speciality chemical. 2,2-Difluoroethanesulfonyl chloride has been shown to be useful in organic chemistry reactions such as alkylation and condensation reactions. This compound has been used to synthesize important pharmaceuticals, including the anti-cancer drug cyclophosphamide. The high quality of this compound makes it a useful scaffold for other molecules.Formula:C2H3ClF2O2SPurity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:164.56 g/mol2,2-Difluoroethanesulfonyl Chloride
CAS:Controlled ProductFormula:C2H3ClF2O2SColor and Shape:NeatMolecular weight:164.56


