CAS 103394-76-9
:2-AMINO-3-PYRIDIN-2-YL-PROPIONIC ACID ETHYL ESTER
Description:
2-Amino-3-pyridin-2-yl-propionic acid ethyl ester, identified by its CAS number 103394-76-9, is an organic compound characterized by its pyridine ring and amino acid structure. This compound features an ethyl ester functional group, which contributes to its solubility and reactivity. The presence of the amino group (-NH2) and the carboxylic acid moiety (in the form of an ester) suggests that it may exhibit properties typical of amino acids, such as potential for forming hydrogen bonds and participating in various biochemical reactions. The pyridine ring can influence the compound's electronic properties and may enhance its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the ethyl ester group can affect the compound's lipophilicity, potentially impacting its absorption and distribution in biological systems. Overall, this compound may have applications in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-2-14-10(13)9(11)7-8-5-3-4-6-12-8/h3-6,9H,2,7,11H2,1H3
SMILES:CCOC(=O)C(Cc1ccccn1)N
Synonyms:- 2-Pyridinepropanoic Acid, Alpha-Amino-, Ethyl Ester
- Ethyl 3-pyridin-2-ylalaninate
- Ethyl-3-pyridin-2-ylalaninat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
