
CAS 1033955-78-0
:Methyl 4-iodo-3-pyridinecarboxylate
Description:
Methyl 4-iodo-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the iodo substituent at the 4-position and a carboxylate group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to the hydrophobic nature of the aromatic ring. Methyl 4-iodo-3-pyridinecarboxylate can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of iodine and the potential for toxicity associated with pyridine derivatives.
Formula:C7H6INO2
InChI:InChI=1S/C7H6INO2/c1-11-7(10)5-4-9-3-2-6(5)8/h2-4H,1H3
InChI key:InChIKey=XYUMHCBHMGKHBG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(I)=CC=NC1
Synonyms:- 3-Pyridinecarboxylic acid, 4-iodo-, methyl ester
- Methyl 4-iodo-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.