CAS 1034-41-9
:Chlordecone alcohol
Description:
Chlordecone alcohol, with the CAS number 1034-41-9, is a chemical compound that is a derivative of chlordecone, a synthetic organochlorine compound. It is characterized by its structure, which includes multiple chlorine atoms attached to a polycyclic framework. This compound is primarily known for its use as a pesticide, particularly in agricultural applications, although its use has been restricted or banned in many countries due to environmental and health concerns. Chlordecone alcohol is lipophilic, meaning it has a high affinity for fats and oils, which can lead to bioaccumulation in living organisms. Its persistence in the environment raises concerns about soil and water contamination, as well as potential long-term effects on human health, including endocrine disruption and neurotoxicity. The compound is typically analyzed using advanced techniques such as gas chromatography and mass spectrometry to monitor its presence in environmental samples. Overall, chlordecone alcohol exemplifies the challenges associated with the use of persistent organic pollutants in agriculture and their impact on ecosystems and human health.
Formula:C10H2Cl10O
InChI:InChI=1S/C10H2Cl10O/c11-2-1(21)3(12)6(15)4(2,13)8(17)5(2,14)7(3,16)9(6,18)10(8,19)20/h1,21H
InChI key:InChIKey=MBEIHNKADVMCJM-UHFFFAOYSA-N
SMILES:ClC12C3(Cl)C4(Cl)C(Cl)(Cl)C1(Cl)C5(Cl)C2(Cl)C(O)C3(Cl)C45Cl
Synonyms:- 1,3,4-Metheno-1H-cyclobuta[cd]pentalen-2-ol, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-
- 1,1a,3,3a,4,5,5,5a,5b,6-Decachlorooctahydro-1,3,4-metheno-1H-cyclobuta[cd]pentalen-2-ol
- Chlordecone alcohol
- Reduced kepone
- Kepone alcohol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
