
CAS 103404-57-5
:1,2,3-Heptanetriol
Description:
1,2,3-Heptanetriol, with the CAS number 103404-57-5, is a triol, meaning it contains three hydroxyl (-OH) functional groups. This compound is characterized by its seven-carbon chain, which contributes to its classification as a heptane derivative. The presence of hydroxyl groups makes it a polar molecule, enhancing its solubility in water compared to non-alcoholic hydrocarbons. 1,2,3-Heptanetriol is typically a colorless, viscous liquid at room temperature and has a relatively high boiling point due to the hydrogen bonding capabilities of its hydroxyl groups. It is used in various applications, including as a potential intermediate in organic synthesis and in the formulation of certain cosmetic and pharmaceutical products. The compound's structure allows for multiple isomeric forms, but the specific arrangement of the hydroxyl groups in the 1,2,3 positions is crucial for its chemical behavior and reactivity. Overall, 1,2,3-Heptanetriol exhibits properties typical of polyols, including hygroscopicity and the ability to participate in various chemical reactions, such as esterification.
Formula:C7H16O3
InChI:InChI=1S/C7H16O3/c1-2-3-4-6(9)7(10)5-8/h6-10H,2-5H2,1H3
InChI key:InChIKey=HXYCHJFUBNTKQR-UHFFFAOYSA-N
SMILES:C(C(CO)O)(CCCC)O
Synonyms:- 1,2,3-Heptanetriol
- 1,2,3-Trihydroxyheptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.