CAS 103404-72-4
:L-Leucine, L-lysyl-, monoacetate
Description:
L-Leucine, L-lysyl-, monoacetate is a dipeptide derivative that combines the amino acids leucine and lysine, with an acetyl group added to the lysine residue. This compound is characterized by its role in protein synthesis and its importance in various biological processes. L-Leucine is a branched-chain amino acid (BCAA) that plays a crucial role in muscle metabolism and energy production, while L-lysine is essential for protein synthesis and the production of hormones and enzymes. The monoacetate form indicates that one of the amino groups in lysine has been acetylated, which can influence the compound's solubility, stability, and biological activity. This modification may enhance its absorption and utilization in biological systems. The compound is typically used in research settings, particularly in studies related to nutrition, metabolism, and the development of peptide-based therapeutics. Its properties, such as solubility in water and potential interactions with other biomolecules, make it a subject of interest in both biochemical and pharmaceutical research.
Formula:C12H25N3O3·C2H4O2
InChI:InChI=1S/C12H25N3O3.C2H4O2/c1-8(2)7-10(12(17)18)15-11(16)9(14)5-3-4-6-13;1-2(3)4/h8-10H,3-7,13-14H2,1-2H3,(H,15,16)(H,17,18);1H3,(H,3,4)/t9-,10-;/m0./s1
InChI key:InChIKey=VAGRBXWQTXIVKV-IYPAPVHQSA-N
SMILES:[C@H](NC([C@H](CCCCN)N)=O)(CC(C)C)C(O)=O.C(C)(O)=O
Synonyms:- <span class="text-smallcaps">L</smallcap>-Leucine, <smallcap>L</span>-lysyl-, monoacetate
- <span class="text-smallcaps">L</smallcap>-Leucine, N-<smallcap>L</span>-lysyl-, monoacetate
- H-Lys-Leu-Oh Acetate Salt
- L-Leucine, N-L-lysyl-, monoacetate
- L-Leucine, L-lysyl-, monoacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Lys-Leu-OH acetate salt
CAS:H-Lys-Leu-OH acetate salt is a derivatized amino acid ester that is used for the detection of lysine and leucine. It is used as an analyte in microextraction, with a sensitivity of 0.25 ng/mL, which can be increased to 0.5 ng/mL by derivatization. H-Lys-Leu-OH acetate salt has been used in the detection of acids and bases, particularly carboxylic acids and basic amino acids, respectively.
Formula:C12H25N3O3·C2H4O2Purity:Min. 95%Molecular weight:319.4 g/mol

