CAS 10341-75-0

Ethanone, 1-phenyl-, oxime, (1E)-

Description:

Ethanone, 1-phenyl-, oxime, (1E)-, also known as phenylacetone oxime, is an organic compound characterized by the presence of a phenyl group attached to an ethanone structure, with an oxime functional group. Its molecular formula typically includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its structure. The compound is known for its use in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. It exhibits properties typical of oximes, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The (1E)- designation indicates the specific geometric configuration of the double bond in the oxime group, which can affect its chemical behavior and interactions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, Ethanone, 1-phenyl-, oxime, (1E)- is a valuable compound in synthetic organic chemistry with specific applications in various chemical processes.

Formula: C₈H₉NO

InChI: InChI=1S/C8H9NO/c1-7(9-10)8-5-3-2-4-6-8/h2-6,10H,1H3/b9-7+

InChI key: InChIKey=JHNRZXQVBKRYKN-VQHVLOKHSA-N

SMILES: C(=N\O)(\C)/C1=CC=CC=C1

Synonyms:

• Ethanone, 1-phenyl-, oxime, (E)-
• (E)-Acetophenone oxime
• Ethanone, 1-phenyl-, oxime, (1E)-
• Acetophenone (E)-oxime
• Acetophenone, oxime, (E)-