CAS 10341-87-4

2-Bromo-3-phenylthiophene

Description:

2-Bromo-3-phenylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the second position and a phenyl group at the third position of the thiophene ring contributes to its unique chemical properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as dichloromethane and ethanol, but less soluble in water due to its hydrophobic nature. It is known for its potential applications in organic electronics, particularly in the development of organic semiconductors and photovoltaic materials. The bromine substituent can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Additionally, the phenyl group enhances the stability and electronic properties of the compound, influencing its reactivity and interactions with other molecules. Overall, 2-Bromo-3-phenylthiophene is a versatile compound with significant implications in materials science and organic synthesis.

Formula: C₁₀H₇BrS

InChI: InChI=1S/C10H7BrS/c11-10-9(6-7-12-10)8-4-2-1-3-5-8/h1-7H

InChI key: InChIKey=XXJDQMSXISTAFG-UHFFFAOYSA-N

SMILES: BrC1=C(C=CS1)C2=CC=CC=C2

Synonyms:

• Thiophene, 2-bromo-3-phenyl-
• 2-Bromo-3-phenylthiophene