CAS 103412-36-8
:N~5~-(diaminomethylidene)-D-ornithyl-N~5~-(diaminomethylidene)-L-ornithyl-(4R)-4-hydroxy-L-prolyl-L-prolylglycyl-3-(thiophen-2-yl)-L-alanyl-L-seryl-D-phenylalanyl-3-(thiophen-2-yl)-L-alanyl-N~5~-(diaminomethylidene)-L-ornithine
Description:
The chemical substance with the name "N~5~-(diaminomethylidene)-D-ornithyl-N~5~-(diaminomethylidene)-L-ornithyl-(4R)-4-hydroxy-L-prolyl-L-prolylglycyl-3-(thiophen-2-yl)-L-alanyl-L-seryl-D-phenylalanyl-3-(thiophen-2-yl)-L-alanyl-N~5~-(diaminomethylidene)-L-ornithine" and CAS number "103412-36-8" is a complex peptide compound characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This substance features diaminomethylidene groups, which are indicative of its potential role in biological systems, particularly in relation to nitric oxide synthesis and signaling pathways. The presence of thiophene rings suggests possible interactions with biological membranes or receptors, enhancing its pharmacological properties. Additionally, the stereochemistry of the amino acids, including both D- and L-forms, may influence its biological activity and interactions with enzymes or receptors. Overall, this compound's unique combination of structural elements positions it as a candidate for further research in medicinal chemistry and biochemistry, particularly in the context of drug development and therapeutic applications.
Formula:C56H83N19O13S2
InChI:InChI=1/C56H83N19O13S2/c57-35(14-4-18-64-54(58)59)45(79)69-36(15-5-19-65-55(60)61)51(85)75-29-32(77)25-43(75)52(86)74-21-7-17-42(74)50(84)67-28-44(78)68-39(26-33-12-8-22-89-33)47(81)73-41(30-76)49(83)71-38(24-31-10-2-1-3-11-31)46(80)72-40(27-34-13-9-23-90-34)48(82)70-37(53(87)88)16-6-20-66-56(62)63/h1-3,8-13,22-23,32,35-43,76-77H,4-7,14-21,24-30,57H2,(H,67,84)(H,68,78)(H,69,79)(H,70,82)(H,71,83)(H,72,80)(H,73,81)(H,87,88)(H4,58,59,64)(H4,60,61,65)(H4,62,63,66)/t32-,35-,36+,37+,38-,39+,40+,41+,42+,43+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
HOE-K86-4321
CAS:HOE-K86-4321 is a Bradykinin antagonist.Formula:C56H83N19O13S2Color and Shape:SolidMolecular weight:1294.51H-D-Arg-Arg-Pro-Hyp-Gly-β-(2-thienyl)-Ala-Ser-D-Phe-b-(2-thienyl)-Ala-Arg-OH
CAS:Enalaprilat is a prodrug that is converted to the active drug enalapril in vivo. It is a potent angiotensin-converting enzyme (ACE) inhibitor that prevents the conversion of angiotensin I to angiotensin II, which leads to vasodilatation and reduced blood pressure. Enalaprilat has been shown to be effective in lowering blood pressure in patients with cardiac insufficiency or hypertension. It also has been shown to decrease the production of endogenous bradykinin, which acts on its receptor B2, leading to vasodilatation and reduced blood pressure. The most common side effect of enalaprilat therapy is cutaneous reactions such as erythema, rash, or pruritus.Formula:C56H83N19O13S2Purity:Min. 95%Molecular weight:1,294.51 g/mol

