CymitQuimica logo

CAS 1034142-33-0

:

N,N-Dimethyl[2-[3-(1,3,5-trimethyl-1H-pyrazol-4-yl)phenyl]ethyl]amine

Description:
N,N-Dimethyl[2-[3-(1,3,5-trimethyl-1H-pyrazol-4-yl)phenyl]ethyl]amine is a chemical compound characterized by its complex structure, which includes a dimethylamino group and a phenyl ring substituted with a pyrazole moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the pyrazole ring, known for its aromaticity and potential biological activity, may contribute to the compound's reactivity and interaction with biological systems. It is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions. The compound may also possess lipophilic characteristics due to the presence of multiple methyl groups, which can influence its solubility in organic solvents. Additionally, its unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and safety profile. As with any chemical substance, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C16H23N3
InChI:InChI=1S/C16H23N3/c1-12-16(13(2)19(5)17-12)15-8-6-7-14(11-15)9-10-18(3)4/h6-8,11H,9-10H2,1-5H3
InChI key:InChIKey=MFUWRMRKXKCSPL-UHFFFAOYSA-N
SMILES:CC=1C(C2=CC(CCN(C)C)=CC=C2)=C(C)N(C)N1
Synonyms:
  • N,N-Dimethyl[2-[3-(1,3,5-trimethyl-1H-pyrazol-4-yl)phenyl]ethyl]amine
  • N,N-Dimethyl-3-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzeneethanamine
  • Benzeneethanamine, N,N-dimethyl-3-(1,3,5-trimethyl-1H-pyrazol-4-yl)-
  • E 55888
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.