CymitQuimica logo

CAS 103425-17-8

:

1-formylcyclopropane-2-carboxylic acid

Description:
1-Formylcyclopropane-2-carboxylic acid is an organic compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. This compound features a formyl group (-CHO) and a carboxylic acid group (-COOH) attached to the cyclopropane ring, contributing to its reactivity and potential applications in organic synthesis. The presence of both functional groups allows for various chemical reactions, including oxidation and esterification. Typically, compounds like this exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the cyclopropane ring may impart strain, influencing the compound's stability and reactivity. The compound's molecular structure suggests it may participate in various chemical transformations, making it of interest in synthetic organic chemistry. Additionally, its unique structure may lead to interesting biological activities, although specific biological properties would require further investigation. Overall, 1-formylcyclopropane-2-carboxylic acid represents a fascinating example of a small, functionalized cyclic compound with potential utility in chemical research and applications.
Formula:C5H6O3
InChI:InChI=1/C5H6O3/c6-2-3-1-4(3)5(7)8/h2-4H,1H2,(H,7,8)
Synonyms:
  • 1-Formylcyclopropane-2-carboxylic acid
  • 2-formylcyclopropanecarboxylic acid
  • CPSSA
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.