CAS 103426-97-7
:1,2,3,5,6,7-Hexachloronaphthalene
Description:
1,2,3,5,6,7-Hexachloronaphthalene is a chlorinated aromatic compound characterized by the presence of six chlorine atoms attached to a naphthalene ring. This compound is part of a larger class of chemicals known as polycyclic aromatic hydrocarbons (PAHs), which are known for their stability and persistence in the environment. It typically appears as a solid at room temperature and is insoluble in water but soluble in organic solvents. The presence of multiple chlorine atoms contributes to its hydrophobic nature and potential bioaccumulation in living organisms. 1,2,3,5,6,7-Hexachloronaphthalene has been studied for its environmental impact, particularly as a pollutant, and is associated with various toxicological effects, including endocrine disruption. Its production and use have been restricted in many regions due to concerns over its persistence and potential health risks. As a result, it is often monitored in environmental samples to assess contamination levels and ecological risk.
Formula:C10H2Cl6
InChI:InChI=1S/C10H2Cl6/c11-5-1-3-4(8(14)9(5)15)2-6(12)10(16)7(3)13/h1-2H
InChI key:InChIKey=XZLJCGGEQLNWDT-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(Cl)=C(Cl)C(Cl)=C2)C=C(Cl)C1Cl
Synonyms:- Naphthalene, 1,2,3,5,6,7-hexachloro-
- PCN 67
- 1,2,3,5,6,7-Hexachloronaphthalene
- 1,2,3,5,6,7-Hexachloronaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.