CymitQuimica logo

CAS 103427-73-2

:

6-[(difluoromethyl)sulfanyl]-N,N'-di(propan-2-yl)-1,3,5-triazine-2,4-diamine

Description:
6-[(Difluoromethyl)sulfanyl]-N,N'-di(propan-2-yl)-1,3,5-triazine-2,4-diamine, with the CAS number 103427-73-2, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered aromatic heterocycle containing three nitrogen atoms. The presence of the difluoromethylsulfanyl group introduces unique reactivity and potential applications in various fields, including agrochemicals and pharmaceuticals. The two isopropyl groups attached to the nitrogen atoms enhance its lipophilicity, potentially influencing its biological activity and solubility. The compound's structure suggests it may exhibit interesting properties such as herbicidal or fungicidal activity, making it a candidate for further research in crop protection. Additionally, the presence of multiple functional groups may allow for diverse chemical modifications, leading to the development of new derivatives with tailored properties. As with many triazine compounds, safety and environmental impact assessments are crucial for its application in any practical context.
Formula:C10H17F2N5S
InChI:InChI=1/C10H17F2N5S/c1-5(2)13-8-15-9(14-6(3)4)17-10(16-8)18-7(11)12/h5-7H,1-4H3,(H2,13,14,15,16,17)
SMILES:CC(C)N=c1[nH]c(=NC(C)C)[nH]c(n1)SC(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.