CAS 103429-71-6

Phthalazine, 1,1′-hydrazonobis-

Description:

Phthalazine, 1,1′-hydrazonobis- is a chemical compound characterized by its hydrazone functional group, which is formed from the reaction of phthalazine with hydrazine. This compound typically exhibits a molecular structure that includes two phthalazine moieties linked by a hydrazone bond. It is often studied for its potential applications in various fields, including medicinal chemistry and materials science, due to its unique electronic properties and ability to form coordination complexes. The compound may display interesting biological activities, making it a subject of research in pharmacology. In terms of physical properties, it may be expected to be a solid at room temperature, with solubility characteristics that depend on the specific substituents and the overall molecular structure. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. As with any chemical, detailed studies and analyses are necessary to fully understand its properties and potential applications.

Formula: C₁₆H₁₂N₆

InChI: InChI=1S/C16H12N6/c17-22(15-13-7-3-1-5-11(13)9-18-20-15)16-14-8-4-2-6-12(14)10-19-21-16/h1-10H,17H2

InChI key: InChIKey=OFDIGVKKNVCXQM-UHFFFAOYSA-N

SMILES: N(N)(C=1C2=C(C=NN1)C=CC=C2)C=3C4=C(C=NN3)C=CC=C4

Synonyms:

• Phthalazine, 1,1′-hydrazonobis-

Hydralazine Impurity 3

CAS: 103429-71-6

Formula: C₁₆H₁₂N₆

Molecular weight: 288.31

Ref: 4Z-H-1311